| Biological Activity | |||||||||||||||||||||||||
| Synonyms | PGD2 | ||||||||||||||||||||||||
| Chemical Name | (5Z,9α,13E,15S)-9,15-Dihydroxy-11-oxoprosta-5,13-dien-1-oic-acid | ||||||||||||||||||||||||
| Application | Prostaglandin D2 (PGD2) is one of the major PGs actively produced in the brain of various mammals | ||||||||||||||||||||||||
| CAS Number | 41598-07-6 | ||||||||||||||||||||||||
| Purity | ≥98.0% | ||||||||||||||||||||||||
| Molecular Weight | 352.47 | ||||||||||||||||||||||||
| Molecular Formula | C₂₀H₃₂O₅ | ||||||||||||||||||||||||
| SMILES | CCCCCC(O)/C=C/[C@H]1C(=O)CC(O)C1C/C=CCCCC(=O)O | ||||||||||||||||||||||||
| Target & IC50 | ovarian cancer cell: IC50 = 6.8 μM | ||||||||||||||||||||||||
| Shipping | Gel Pack | ||||||||||||||||||||||||
| Storage | Store at -20°C | ||||||||||||||||||||||||
|
|||||||||||||||||||||||||
| Solubility | |
| DMSO: 50 mg/ml (141.87mM) Ethanol 100 mg/ml (283.71mM) |
| Product Description | |
Prostaglandin D2 is the major prostaglandin produced by mast cells and is the primary prostaglandin in the brain. It causes vasodilation, induces inflammation, and its presence in hair follicles may be partially responsible for male pattern baldness. Prostaglandin D2 is released during asthmatic and allergic reactions. |
