| Biological Activity | |
| Synonyms | cGAMP, cyclic GMP-AMP |
| Application | 2',3'-cGAMP is an endogenous cGAMP in mammalian cells |
| CAS Number | 1441190-66-4 |
| Purity | ≥98.0% |
| Molecular Weight | 674.4 |
| Molecular Formula | C20H24N10O13P2 |
| SMILES | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C3NC(=NC4=O)N)OP(=O)(OC[C@@H]5[C@H]([C@H]([C@@H](O5)N6C=NC7=C6N=CN=C7N)O)OP(=O)(O1)O)O)O |
| Shipping | Gel Pack |
| Storage | Store at -20°C |
| Product Description | |
2',3'-cGAMP binds to STING (stimulator of IFN genes) and functions as an endognous second messenger to activate the innate immune system. It is produced by the cyclic GMP-AMP synthase (cGAS) from ATP and GTP upon cytosolic DNA stimulation. |
