| Biological Activity |
| Synonyms |
CC-10004, CC 10004, CC10004 |
| Chemical Name |
(S)-N-(2-(1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethyl)-1,3-dioxoisoindolin-4-yl)acetamide |
| Application |
Apremilast is a potent and orally active PDE4 (IC50=74 nM) with anti-inflammation activities. |
| CAS Number |
608141-41-9 |
| Purity |
≥99.0% |
| Molecular Weight |
460.5 |
| Molecular Formula |
C22H24N2O7S |
| SMILES |
C(=O)1C2=C(C(NC(C)=O)=CC=C2)C(=O)N1[C@H](C1=CC=C(OC)C(OCC)=C1)CS(C)(=O)=O |
| Target & IC50 |
PDE4: IC50 = 74 nM
TNF-α: IC50 = 77 nM |
| Shipping |
Gel Pack |
| Storage |
Store at -20°C |
| Preparing Stock Solutions |
Molecular Structure |
| ConcentrationSolventMass |
1 mg |
5 mg |
10 mg |
| 1 mM |
2.1716 ml |
10.8578 ml |
21.7155 ml |
| 5 mM |
0.4343 ml |
2.1716 ml |
4.3431 ml |
| 10 mM |
0.2172 ml |
1.0858 ml |
2.1716 ml |
| 50 mM |
0.0434 ml |
0.2172 ml |
0.4343 ml |
|
|
|
