| Biological Activity |
| Synonyms |
Nutlin3, p53/MDM2 Agonist |
| Chemical Name |
4-(4,5-bis(4-chlorophenyl)-2-(2-isopropoxy-4-methoxyphenyl)-4,5-dihydro-1H-imidazole-1-carbonyl)piperazin-2-one |
| Application |
Nutlin-3 is an apoptosis inducer and disruptor of MDM2-p53 |
| CAS Number |
548472-68-0 |
| Purity |
≥99.0% |
| Molecular Weight |
581.49 |
| Molecular Formula |
C₃₀H₃₀Cl₂N₄O₄ |
| SMILES |
CC(C)OC1=C(C=CC(=C1)OC)C2=NC(C(N2C(=O)N3CCNC(=O)C3)C4=CC=C(C=C4)Cl)C5=CC=C(C=C5)Cl |
| Target & IC50 |
p53/MDM2 interaction: IC50 = 0.09 μM; 1043SK: IC50 = 2.2 μM (human); NIH/3T3: IC50 = 1.3 μM (mouse) |
| Shipping |
Gel Pack |
| Storage |
Store at -20°C |
| Preparing Stock Solutions |
Molecular Structure |
| ConcentrationSolventMass |
1 mg |
5 mg |
10 mg |
| 1 mM |
1.7197 ml |
8.5986 ml |
17.1972 ml |
| 5 mM |
0.3439 ml |
1.7197 ml |
3.4394 ml |
| 10 mM |
0.1720 ml |
0.8599 ml |
1.7197 ml |
| 50 mM |
0.0344 ml |
0.1720 ml |
0.3439 ml |
|
|
|
